Online Database of Chemicals from Around the World
|
CAS#: 104294-16-8 Product: 1,3,5-Trichloro-2-(2,4-Dichlorophenoxy)Benzene No suppilers available for the product. |
| Name | 1,3,5-Trichloro-2-(2,4-Dichlorophenoxy)Benzene |
|---|---|
| Synonyms | Inchi=1/C12h5cl5o/C13-6-1-2-11(8(15)3-6)18-12-9(16)4-7(14)5-10(12)17/H1-5; Benzene, 1,3,5-Trichloro-2-(2,4-Dichlorophenoxy)-; 2,2',4,4',6-Pentachlorodiphenyl Ether |
| Molecular Structure |  |
| Molecular Formula | C12H5Cl5O |
| Molecular Weight | 342.44 |
| CAS Registry Number | 104294-16-8 |
| SMILES | C1=C(Cl)C=C(Cl)C(=C1Cl)OC2=CC=C(Cl)C=C2Cl |
| InChI | 1S/C12H5Cl5O/c13-6-1-2-11(8(15)3-6)18-12-9(16)4-7(14)5-10(12)17/h1-5H |
| InChIKey | FONWDRSQXQZNBN-UHFFFAOYSA-N |
| Density | 1.558g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.973°C at 760 mmHg (Cal.) |
| Flash point | 121.941°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trichloro-2-(2,4-Dichlorophenoxy)Benzene |