Online Database of Chemicals from Around the World
|
CAS#: 6968-15-6 Product: 1,1,1-Trichloro-2-(Dichloromethyl)-3,3,3-Trifluoro-Propane No suppilers available for the product. |
| Name | 1,1,1-Trichloro-2-(Dichloromethyl)-3,3,3-Trifluoro-Propane |
|---|---|
| Synonyms | 1,1,1-Trichloro-2-(Dichloromethyl)-3,3,3-Trifluoro-Propane; Nsc20658 |
| Molecular Structure |  |
| Molecular Formula | C4H2Cl5F3 |
| Molecular Weight | 284.32 |
| CAS Registry Number | 6968-15-6 |
| SMILES | C(C(Cl)(Cl)Cl)(C(Cl)Cl)C(F)(F)F |
| InChI | 1S/C4H2Cl5F3/c5-2(6)1(3(7,8)9)4(10,11)12/h1-2H |
| InChIKey | IQLJGAZAAZMRDB-UHFFFAOYSA-N |
| Density | 1.686g/cm3 (Cal.) |
|---|---|
| Boiling point | 188.017°C at 760 mmHg (Cal.) |
| Flash point | 82.252°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trichloro-2-(Dichloromethyl)-3,3,3-Trifluoro-Propane |