| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | cis-Ozagrel |
|---|---|
| Synonyms | (Z)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 |
| CAS Registry Number | 143945-86-2 |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)/C=CC(=O)O |
| Solubility | 700.6 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.593, Calc.* |
| Melting point | 169.42 °C |
| Boiling Point | 428.33 °C, 468.0±25.0 °C (760 mmHg), Calc.* |
| Flash Point | 236.8±23.2 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for cis-Ozagrel |