Online Database of Chemicals from Around the World
|
CAS#: 15131-84-7 Product: Chrysene-5,6-Oxide No suppilers available for the product. |
| Name | Chrysene-5,6-Oxide |
|---|---|
| Synonyms | Chrysene 5,6-Epoxide; Chrysene 5,6-Oxide; Chrysene, K-Region Epoxide |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 15131-84-7 |
| SMILES | C1=CC4=C(C2=C1C=CC=C2)C3OC3C5=C4C=CC=C5 |
| InChI | 1S/C18H12O/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-18(19-17)16(12)14/h1-10,17-18H |
| InChIKey | VYYARLZUMSKDPQ-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.252°C at 760 mmHg (Cal.) |
| Flash point | 212.364°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chrysene-5,6-Oxide |