|
CAS#: 2051-10-7 Product: Chrysene-5,6-Dione No suppilers available for the product. |
| Name | Chrysene-5,6-Dione |
|---|---|
| Synonyms | Chrysene-5,6-Quinone; 4-07-00-02646 (Beilstein Handbook Reference); 5,6-Chrysoquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H10O2 |
| Molecular Weight | 258.28 |
| CAS Registry Number | 2051-10-7 |
| SMILES | C1=C3C(=C2C(=C1)C=CC=C2)C(C(=O)C4=CC=CC=C34)=O |
| InChI | 1S/C18H10O2/c19-17-15-8-4-3-7-13(15)14-10-9-11-5-1-2-6-12(11)16(14)18(17)20/h1-10H |
| InChIKey | HZGMNNQOPOLCIG-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.035°C at 760 mmHg (Cal.) |
| Flash point | 210.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chrysene-5,6-Dione |