Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Chrysene-trans-3,4-Dihydrodiol |
|---|---|
| Synonyms | Ccris 2020; Chrysene-3,4-Diol, 3,4-Dihydro-, Trans-; Trans-3,4-Dihydro-3,4-Dihydroxychrysene |
| Molecular Structure |  |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 |
| CAS Registry Number | 64920-32-7 |
| SMILES | [C@@H]4(O)C1=C(C=CC2=C1C=CC3=C2C=CC=C3)C=C[C@H]4O |
| InChI | 1S/C18H14O2/c19-16-10-7-12-6-8-14-13-4-2-1-3-11(13)5-9-15(14)17(12)18(16)20/h1-10,16,18-20H/t16-,18+/m1/s1 |
| InChIKey | XOKPMCWSKPASGO-AEFFLSMTSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.242°C at 760 mmHg (Cal.) |
| Flash point | 257.172°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chrysene-trans-3,4-Dihydrodiol |