Online Database of Chemicals from Around the World
|
CAS#: 22975-76-4 Product: 4,4'-Dimethylangelicin No suppilers available for the product. |
| Name | 4,4'-Dimethylangelicin |
|---|---|
| Synonyms | 4,9-Dimethyl-2-Furo[2,3-H]Chromenone; 2H-Furo(2,3-H)(1)Benzopyran-2-One, 4,9-Dimethyl-, Plus Ultraviolet A Radiation; 2H-Furo(2,3-H)-1-Benzopyran-2-One, 4,9-Dimethyl- (8Ci,9Ci) |
| Molecular Structure |  |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 22975-76-4 |
| SMILES | C2=CC1=C(C(=CO1)C)C3=C2C(=CC(=O)O3)C |
| InChI | 1S/C13H10O3/c1-7-5-11(14)16-13-9(7)3-4-10-12(13)8(2)6-15-10/h3-6H,1-2H3 |
| InChIKey | ZUOUYRRXKPHFSV-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.359°C at 760 mmHg (Cal.) |
| Flash point | 186.254°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dimethylangelicin |