Online Database of Chemicals from Around the World
|
CAS#: 90370-11-9 Product: 6,5'-Dimethylangelicin No suppilers available for the product. |
| Name | 6,5'-Dimethylangelicin |
|---|---|
| Synonyms | 6,8-Dimethyl-2-Furo[2,3-H]Chromenone; 2H-Furo(2,3-H)-1-Benzopyran-2-One, 6,8-Dimethyl-; 6,5'-Dimethylangelicin |
| Molecular Structure |  |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 90370-11-9 |
| SMILES | C2=C(C)OC3=C(C)C=C1C=CC(=O)OC1=C23 |
| InChI | 1S/C13H10O3/c1-7-5-9-3-4-11(14)16-13(9)10-6-8(2)15-12(7)10/h3-6H,1-2H3 |
| InChIKey | VWISGRNVMLSLCE-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.945°C at 760 mmHg (Cal.) |
| Flash point | 187.213°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,5'-Dimethylangelicin |