Online Database of Chemicals from Around the World
|
CAS#: 4063-41-6 Product: 4,5'-Dimethylangelicin No suppilers available for the product. |
| Name | 4,5'-Dimethylangelicin |
|---|---|
| Synonyms | 4,8-Dimethyl-2-Furo[2,3-H]Chromenone; Aids132707; 5-Benzofuranacrylic Acid, 4-Hydroxy-.Beta.,2-Dimethyl-, .Delta.-Lactone |
| Molecular Structure |  |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 4063-41-6 |
| SMILES | C1=C(C)OC3=C1C2=C(C(=CC(O2)=O)C)C=C3 |
| InChI | 1S/C13H10O3/c1-7-5-12(14)16-13-9(7)3-4-11-10(13)6-8(2)15-11/h3-6H,1-2H3 |
| InChIKey | PFFGIQUVLUEURV-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.504°C at 760 mmHg (Cal.) |
| Flash point | 184.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5'-Dimethylangelicin |