Online Database of Chemicals from Around the World
|
CAS#: 26581-91-9 Product: 2-(2,6-Dioxopiperidine-4-yl)phthalimidine No suppilers available for the product. |
| Name | 2-(2,6-Dioxopiperidine-4-yl)phthalimidine |
|---|---|
| Synonyms | 4-(1-Oxoisoindolin-2-Yl)Piperidine-2,6-Dione; 4-(1-Oxo-2-Isoindolinyl)Piperidine-2,6-Dione; 4-(1-Ketoisoindolin-2-Yl)Piperidine-2,6-Quinone |
| Molecular Structure |  |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 26581-91-9 |
| SMILES | C1=CC=CC3=C1CN(C2CC(NC(C2)=O)=O)C3=O |
| InChI | 1S/C13H12N2O3/c16-11-5-9(6-12(17)14-11)15-7-8-3-1-2-4-10(8)13(15)18/h1-4,9H,5-7H2,(H,14,16,17) |
| InChIKey | HQJCJCCAXMOMEU-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.257°C at 760 mmHg (Cal.) |
| Flash point | 276.909°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,6-Dioxopiperidine-4-yl)phthalimidine |