Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(Dichloromethyl)-2-Nitrobenzene |
|---|---|
| Synonyms | 1-(Dichloromethyl)-2-Nitro-Benzene |
| Molecular Structure |  |
| Molecular Formula | C7H5Cl2NO2 |
| Molecular Weight | 206.03 |
| CAS Registry Number | 3284-77-3 |
| EINECS | 221-931-0 |
| SMILES | C1=CC=CC(=C1C(Cl)Cl)[N+]([O-])=O |
| InChI | 1S/C7H5Cl2NO2/c8-7(9)5-3-1-2-4-6(5)10(11)12/h1-4,7H |
| InChIKey | IREGSVSQCKFDNG-UHFFFAOYSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.801°C at 760 mmHg (Cal.) |
| Flash point | 148.42°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Dichloromethyl)-2-Nitrobenzene |