Online Database of Chemicals from Around the World
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (919) 678-0702 | |||
 |
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | 2,6-Dichloro-3-Methyl-4-Nitrophenol |
|---|---|
| Synonyms | 2,6-Dichloro-3-Methyl-4-Nitro-Phenol; 2,6-Dichloro-4-Nitro-M-Cresol |
| Molecular Structure |  |
| Molecular Formula | C7H5Cl2NO3 |
| Molecular Weight | 222.03 |
| CAS Registry Number | 37693-15-5 |
| EINECS | 253-633-1 |
| SMILES | C1=C(Cl)C(=C(Cl)C(=C1[N+]([O-])=O)C)O |
| InChI | 1S/C7H5Cl2NO3/c1-3-5(10(12)13)2-4(8)7(11)6(3)9/h2,11H,1H3 |
| InChIKey | BIXNDXIFMLMASZ-UHFFFAOYSA-N |
| Density | 1.587g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.703°C at 760 mmHg (Cal.) |
| Flash point | 134.451°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichloro-3-Methyl-4-Nitrophenol |