Online Database of Chemicals from Around the World
| Leap Chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (852) 3060-6658 | |||
 |
market19@leapchem.com | |||
 |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | 1,5-Dichloro-2-Methyl-4-Nitrobenzene |
|---|---|
| Synonyms | 1,5-Dichloro-2-Methyl-4-Nitro-Benzene; Nsc72331; 2,4-Dichloro-5-Nitrotoluene |
| Molecular Formula | C7H5Cl2NO2 |
| Molecular Weight | 206.03 |
| CAS Registry Number | 7149-77-1 |
| SMILES | C1=C(C)C(=CC(=C1[N+](=O)[O-])Cl)Cl |
| InChI | 1S/C7H5Cl2NO2/c1-4-2-7(10(11)12)6(9)3-5(4)8/h2-3H,1H3 |
| InChIKey | OTHIQMSDVAQZQM-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.251°C at 760 mmHg (Cal.) |
| Flash point | 132.968°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,5-Dichloro-2-Methyl-4-Nitrobenzene |