Online Database of Chemicals from Around the World
|
CAS#: 83704-46-5 Product: 1,6,7-Trichlorodibenzofuran No suppilers available for the product. |
| Name | 1,6,7-Trichlorodibenzofuran |
|---|---|
| Synonyms | 3,4,9-Trichlorodibenzofuran; Dibenzofuran, 3,4,9-Trichloro |
| Molecular Structure |  |
| Molecular Formula | C12H5Cl3O |
| Molecular Weight | 271.53 |
| CAS Registry Number | 83704-46-5 |
| SMILES | C1=CC=C3C(=C1Cl)C2=C(C(=C(C=C2)Cl)Cl)O3 |
| InChI | 1S/C12H5Cl3O/c13-7-2-1-3-9-10(7)6-4-5-8(14)11(15)12(6)16-9/h1-5H |
| InChIKey | HEWLCNCSWBMZHG-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.551°C at 760 mmHg (Cal.) |
| Flash point | 189.394°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6,7-Trichlorodibenzofuran |