Online Database of Chemicals from Around the World
|
CAS#: 478-45-5 Product: Emodic acid No suppilers available for the product. |
| Name | Emodic acid |
|---|---|
| Synonyms | 4,5,7-Trihydroxy-9,10-Dioxo-Anthracene-1-Carboxylic Acid; 4,5,7-Trihydroxy-9,10-Dioxo-1-Anthracenecarboxylic Acid; 4,5,7-Trihydroxy-9,10-Diketo-Anthracene-1-Carboxylic Acid |
| Molecular Structure |  |
| Molecular Formula | C15H8O7 |
| Molecular Weight | 300.22 |
| CAS Registry Number | 478-45-5 |
| SMILES | C1=C(O)C=C(O)C2=C1C(=O)C3=C(C2=O)C(=CC=C3C(=O)O)O |
| InChI | 1S/C15H8O7/c16-5-3-7-10(9(18)4-5)14(20)12-8(17)2-1-6(15(21)22)11(12)13(7)19/h1-4,16-18H,(H,21,22) |
| InChIKey | CUUCCKPDUGAXQQ-UHFFFAOYSA-N |
| Density | 1.799g/cm3 (Cal.) |
|---|---|
| Boiling point | 689.334°C at 760 mmHg (Cal.) |
| Flash point | 384.664°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Emodic acid |