Online Database of Chemicals from Around the World
|
CAS#: 70057-23-7 Product: 1,1,5,6-Tetramethylindan-4-Ol No suppilers available for the product. |
| Name | 1,1,5,6-Tetramethylindan-4-Ol |
|---|---|
| Synonyms | 1,1,5,6-Tetramethylindan-4-Ol; 1,1,5,6-Tetramethyl-4-Indanol |
| Molecular Structure |  |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 70057-23-7 |
| EINECS | 274-295-1 |
| SMILES | C1=C(C(=C(O)C2=C1C(CC2)(C)C)C)C |
| InChI | 1S/C13H18O/c1-8-7-11-10(12(14)9(8)2)5-6-13(11,3)4/h7,14H,5-6H2,1-4H3 |
| InChIKey | DEJZBGOXTSKQOX-UHFFFAOYSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.62°C at 760 mmHg (Cal.) |
| Flash point | 125.266°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,5,6-Tetramethylindan-4-Ol |