Online Database of Chemicals from Around the World
|
CAS#: 93892-36-5 Product: 3,3,4,6-Tetramethylindan-5-Ol No suppilers available for the product. |
| Name | 3,3,4,6-Tetramethylindan-5-Ol |
|---|---|
| Synonyms | 3,3,4,6-Tetramethylindan-5-Ol; 3,3,4,6-Tetramethyl-5-Indanol |
| Molecular Structure |  |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 93892-36-5 |
| EINECS | 299-519-5 |
| SMILES | C1=C(C(=C(C2=C1CCC2(C)C)C)O)C |
| InChI | 1S/C13H18O/c1-8-7-10-5-6-13(3,4)11(10)9(2)12(8)14/h7,14H,5-6H2,1-4H3 |
| InChIKey | FHAYDZGZVUURDI-UHFFFAOYSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.491°C at 760 mmHg (Cal.) |
| Flash point | 126.572°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4,6-Tetramethylindan-5-Ol |