Online Database of Chemicals from Around the World
|
CAS#: 70057-25-9 Product: 3,3,6,7-Tetramethylindan-5-Ol No suppilers available for the product. |
| Name | 3,3,6,7-Tetramethylindan-5-Ol |
|---|---|
| Synonyms | 3,3,6,7-Tetramethylindan-5-Ol; 3,3,6,7-Tetramethyl-5-Indanol |
| Molecular Structure |  |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 70057-25-9 |
| EINECS | 274-296-7 |
| SMILES | C1=C(O)C(=C(C2=C1C(CC2)(C)C)C)C |
| InChI | 1S/C13H18O/c1-8-9(2)12(14)7-11-10(8)5-6-13(11,3)4/h7,14H,5-6H2,1-4H3 |
| InChIKey | QACSMPNJLJBVQD-UHFFFAOYSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.485°C at 760 mmHg (Cal.) |
| Flash point | 132.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,6,7-Tetramethylindan-5-Ol |