|
CAS#: 941-60-6 Product: 1,1,4,6-Tetramethylindane No suppilers available for the product. |
| Name | 1,1,4,6-Tetramethylindane |
|---|---|
| Synonyms | 1,1,4,6-Tetramethylindane; Indan, 1,1,4,6-Tetramethyl-; 1H-Indene, 2,3-Dihydro-1,1,4,6-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 |
| CAS Registry Number | 941-60-6 |
| SMILES | C1=C(C=C(C2=C1C(C)(C)CC2)C)C |
| InChI | 1S/C13H18/c1-9-7-10(2)11-5-6-13(3,4)12(11)8-9/h7-8H,5-6H2,1-4H3 |
| InChIKey | PJPNYZCIGFQVQG-UHFFFAOYSA-N |
| Density | 0.92g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.356°C at 760 mmHg (Cal.) |
| Flash point | 87.689°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,4,6-Tetramethylindane |