| Wuhan Xinlaibokang Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.xblkchem.com | |||
![]() | +86 18202741975 | |||
![]() | 3762793534@qq.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18202741975 | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | API >> Inhibitor drug |
|---|---|
| Name | Recilisib sodium |
| Synonyms | sodium 4-[(E)-2-[(4-chlorophenyl)methylsulfonyl]ethenyl]benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12ClNaO4S |
| Molecular Weight | 358.77 |
| CAS Registry Number | 922139-31-9 |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)/C=C/C2=CC=C(C=C2)C(=O)[O-])Cl.[Na+] |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
|
Recilisib sodium, chemically known as 4-[(3-methyl-2-thienyl)methylamino]-3-nitrobenzoic acid sodium salt, is a promising radioprotectant designed to mitigate the harmful effects of radiation exposure. Its unique properties and potential applications have attracted great interest in medical and defense research. The development of recilisib sodium is part of a broad effort to find effective radioprotective compounds that can be used to protect individuals from the damaging effects of ionizing radiation. This work has gained momentum due to the increasing demand for such agents for medical treatments involving radiation and for protecting military personnel and first responders in nuclear accidents. The discovery process involved extensive screening of various chemical compounds to determine if they could protect cells from radiation-induced damage. Recilisib sodium is a strong candidate due to its ability to activate cellular defense mechanisms and enhance DNA repair processes. Recilisib sodium is a benzoic acid derivative with a complex structure that includes thienyl, nitro, and amine bonds. Its sodium salt form enhances solubility in water, making it more suitable for administration in clinical settings. Recilisib sodium has the molecular formula C13H10N2NaO4S and is usually a crystalline solid. The radioprotective effects of recilisib sodium are attributed to its ability to modulate several cellular pathways involved in the response to radiation damage. Key mechanisms include: Recilisib sodium promotes the activation of enzymes that repair DNA damage caused by ionizing radiation. This helps maintain the integrity of the genetic material in irradiated cells; Radiation exposure generates reactive oxygen species (ROS) that can damage cellular components. Recilisib sodium helps reduce oxidative stress by enhancing the activity of the antioxidant defense system; The compound modulates signaling pathways that control cell survival and apoptosis. By promoting cell survival pathways and inhibiting apoptotic signals, recilisib sodium helps protect cells from radiation-induced death. One of the main applications of recilisib sodium is to protect patients undergoing radiation therapy for cancer. By minimizing damage to healthy tissue surrounding the tumor, it can improve the therapeutic index of radiation therapy and reduce side effects. Recilisib sodium has potential applications in defense, particularly for protecting military personnel and emergency responders from nuclear and radiological events. It can be administered prophylactically or therapeutically to mitigate radiation damage. Space missions expose astronauts to elevated levels of cosmic radiation. Recolexib sodium could be used to protect astronauts from long-term radiation exposure, thus safeguarding their health during long-duration missions. Workers at nuclear power plants and other environments where they may be exposed to radiation could benefit from Recolexib sodium as a protective measure to reduce the risk of radiation-induced health problems. Preclinical studies and clinical trials are essential to determine the safety and effectiveness of Recolexib sodium. Preliminary studies show promise, indicating that it can be administered with minimal side effects. However, thorough clinical evaluation is needed to determine the best dosing regimen and fully understand its long-term safety. References 2024. Serum microRNA profile of rhesus macaques following ionizing radiation exposure and treatment with a medical countermeasure, Ex-Rad. Scientific Reports, 14(1). DOI: 10.1038/s41598-024-54997-8 2023. Analysis of the Proteomic Profile in Serum of Irradiated Nonhuman Primates Treated with Ex-Rad, a Radiation Medical Countermeasure. Journal of Proteome Research, 22(3). DOI: 10.1021/acs.jproteome.2c00458 2021. Analysis of the metabolomic profile in serum of irradiated nonhuman primates treated with Ex-Rad, a radiation countermeasure. Scientific Reports, 11(1). DOI: 10.1038/s41598-021-91067-9 |
| Market Analysis Reports |
| List of Reports Available for Recilisib sodium |