|
CAS#: 20336-95-2 Product: Lithium Decanoate No suppilers available for the product. |
| Name | Lithium Decanoate |
|---|---|
| Synonyms | Lithium Caprate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H19LiO2 |
| Molecular Weight | 178.20 |
| CAS Registry Number | 20336-95-2 |
| EINECS | 243-742-2 |
| SMILES | C(C([O-])=O)CCCCCCCC.[Li+] |
| InChI | 1S/C10H20O2.Li/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | POYDCAKGHSRECA-UHFFFAOYSA-M |
| Boiling point | 269.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium Decanoate |