|
CAS#: 2364-46-7 Product: 1,3,8-Trinitronaphthalene No suppilers available for the product. |
| Name | 1,3,8-Trinitronaphthalene |
|---|---|
| Synonyms | Inchi=1/C10h5n3o6/C14-11(15)7-4-6-2-1-3-8(12(16)17)10(6)9(5-7)13(18)19/H1-5; Nsc27011; Naphthalene, 1,3,8-Trinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5N3O6 |
| Molecular Weight | 263.17 |
| CAS Registry Number | 2364-46-7 |
| SMILES | C1=C(C2=C(C=C1)C=C(C=C2[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C10H5N3O6/c14-11(15)7-4-6-2-1-3-8(12(16)17)10(6)9(5-7)13(18)19/h1-5H |
| InChIKey | BEKZHETVNVFYCV-UHFFFAOYSA-N |
| Density | 1.654g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.377°C at 760 mmHg (Cal.) |
| Flash point | 235.987°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,8-Trinitronaphthalene |