|
CAS#: 94689-31-3 Product: Dimethylindanol No suppilers available for the product. |
| Name | Dimethylindanol |
|---|---|
| Synonyms | 1,2-Dimethylindan-1-Ol; 1,2-Dimethyl-1-Indanol; Dimethylindanol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 |
| CAS Registry Number | 94689-31-3 |
| EINECS | 305-555-5 |
| SMILES | C1=CC=CC2=C1C(O)(C(C2)C)C |
| InChI | 1S/C11H14O/c1-8-7-9-5-3-4-6-10(9)11(8,2)12/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | XTBOPEPHSCCUBK-UHFFFAOYSA-N |
| Density | 1.054g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.749°C at 760 mmHg (Cal.) |
| Flash point | 97.567°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethylindanol |