| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2-(2-Aminoethylsulfonylsulfanyl)Ethanamine |
|---|---|
| Synonyms | 2-(2-Aminoethylsulfonylthio)Ethanamine Hydrochloride; 2-(2-Aminoethylthio)Sulfonylethylamine Hydrochloride; Ethanethiol, 2-Amino-, S-Ester With Thiotaurine, Dihydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C4H13ClN2O2S2 |
| Molecular Weight | 220.73 |
| CAS Registry Number | 10027-70-0 |
| SMILES | [H+].C([S](SCCN)(=O)=O)CN.[Cl-] |
| InChI | 1S/C4H12N2O2S2.ClH/c5-1-3-9-10(7,8)4-2-6;/h1-6H2;1H |
| InChIKey | UHSQGLSSKHZQSU-UHFFFAOYSA-N |
| Boiling point | 394.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Aminoethylsulfonylsulfanyl)Ethanamine |