|
CAS#: 10031-75-1 Product: Diphenylmethylenediisocyanate No suppilers available for the product. |
| Name | Diphenylmethylenediisocyanate |
|---|---|
| Synonyms | (Diisocyanato-Phenyl-Methyl)Benzene; 1,1'-(Diisocyanatomethylene)Bisbenzene; Benzene, 1,1'-(Diisocyanatomethylene)Bis- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 |
| CAS Registry Number | 10031-75-1 |
| SMILES | O=C=NC(C1=CC=CC=C1)(N=C=O)C2=CC=CC=C2 |
| InChI | 1S/C15H10N2O2/c18-11-16-15(17-12-19,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H |
| InChIKey | LNWBFIVSTXCJJG-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.302°C at 760 mmHg (Cal.) |
| Flash point | 134.134°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphenylmethylenediisocyanate |