|
CAS#: 10045-42-8 Product: 5-Methoxy-2-Nitro-Benzimidazole No suppilers available for the product. |
| Name | 5-Methoxy-2-Nitro-Benzimidazole |
|---|---|
| Synonyms | 5-Methoxy-2-Nitrobenzimidazole; Benzimidazole, 5-Methoxy-2-Nitro-; Brn 0789222 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 |
| CAS Registry Number | 10045-42-8 |
| SMILES | C1=C(OC)C=CC2=C1[NH]C(=N2)[N+]([O-])=O |
| InChI | 1S/C8H7N3O3/c1-14-5-2-3-6-7(4-5)10-8(9-6)11(12)13/h2-4H,1H3,(H,9,10) |
| InChIKey | OIFNPDLEMUEBIV-UHFFFAOYSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.948°C at 760 mmHg (Cal.) |
| Flash point | 222.292°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-2-Nitro-Benzimidazole |