Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Oakwood Products, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (800) 467-3386 | |||
|
k_weaver@oakwoodchemical.com | |||
| Chemical manufacturer | ||||
| Name | 4-(Dimethylamino)Phenyl Methyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | dithioate; Methyl (4-dimethylaminophenyl) cyanocarbonimido-; Methyl (4-dimethylaminophenyl) cyanocarbonimido-dithioate |
| Molecular Structure |  |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.37 |
| CAS Registry Number | 100477-75-6 |
| SMILES | CN(C)c1ccc(SC(\SC)=N\C#N)cc1 |
| InChI | 1S/C11H13N3S2/c1-14(2)9-4-6-10(7-5-9)16-11(15-3)13-8-12/h4-7H,1-3H3/b13-11+ |
| InChIKey | VVGRZOSCXWTWKS-ACCUITESSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| 1.04-1.24 (Expl.) | |
| Boiling point | 401.86°C at 760 mmHg (Cal.) |
| Flash point | 196.838°C (Cal.) |
| Refractive index | 1.594 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(Dimethylamino)Phenyl Methyl Cyanocarbonodithioimidate |