| Name | Dimethyl 1,8-Naphthalenedicarboxylate |
|---|---|
| Synonyms | 1,8-Dimethylnaphthoate; 1,8-Naphthalenedicarboxylic acid dimethyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24 |
| CAS Registry Number | 10060-33-0 |
| SMILES | COC(=O)c1cccc2cccc(C(=O)OC)c12 |
| InChI | 1S/C14H12O4/c1-17-13(15)10-7-3-5-9-6-4-8-11(12(9)10)14(16)18-2/h3-8H,1-2H3 |
| InChIKey | OVPXRLUTUWRYEY-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.26°C at 760 mmHg (Cal.) |
| Flash point | 189.212°C (Cal.) |
| Refractive index | 1.594 (Cal.) |
| (1) | L.-H. Jing, D.-B. Qin, L. He, S.-J. Gu, H.-X. Zhang and G. Lei. Dimethyl naphthalene-1,8-dicarboxylate, Acta Cryst. (2005). E61, o3595-o3596 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dimethyl 1,8-Naphthalenedicarboxylate |