Name | Dimethyl 1,8-Naphthalenedicarboxylate |
---|---|
Synonyms | 1,8-Dimethylnaphthoate; 1,8-Naphthalenedicarboxylic acid dimethyl ester |
Molecular Structure | ![]() |
Molecular Formula | C14H12O4 |
Molecular Weight | 244.24 |
CAS Registry Number | 10060-33-0 |
SMILES | COC(=O)c1cccc2cccc(C(=O)OC)c12 |
InChI | 1S/C14H12O4/c1-17-13(15)10-7-3-5-9-6-4-8-11(12(9)10)14(16)18-2/h3-8H,1-2H3 |
InChIKey | OVPXRLUTUWRYEY-UHFFFAOYSA-N |
Density | 1.225g/cm3 (Cal.) |
---|---|
Boiling point | 375.26°C at 760 mmHg (Cal.) |
Flash point | 189.212°C (Cal.) |
Refractive index | 1.594 (Cal.) |
(1) | L.-H. Jing, D.-B. Qin, L. He, S.-J. Gu, H.-X. Zhang and G. Lei. Dimethyl naphthalene-1,8-dicarboxylate, Acta Cryst. (2005). E61, o3595-o3596 |
---|---|
Market Analysis Reports |
List of Reports Available for Dimethyl 1,8-Naphthalenedicarboxylate |