|
CAS#: 10060-70-5 Product: 2-(((4-Aminophenyl)sulfonyl)amino)-Benzoic acid monosodium salt No suppilers available for the product. |
| Name | 2-(((4-Aminophenyl)sulfonyl)amino)-Benzoic acid monosodium salt |
|---|---|
| Synonyms | Aids-007433; Aids007433; Benzoic Acid, 2-[[(4-Aminophenyl)Sulfonyl]Amino]- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.31 |
| CAS Registry Number | 10060-70-5 (530-73-4) |
| SMILES | C1=CC(=CC=C1N)[S](=O)(=O)NC2=C(C=CC=C2)C(O)=O |
| InChI | 1S/C13H12N2O4S/c14-9-5-7-10(8-6-9)20(18,19)15-12-4-2-1-3-11(12)13(16)17/h1-8,15H,14H2,(H,16,17) |
| InChIKey | FQQBKLWSOPUVAC-UHFFFAOYSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.394°C at 760 mmHg (Cal.) |
| Flash point | 280.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(((4-Aminophenyl)sulfonyl)amino)-Benzoic acid monosodium salt |