|
CAS#: 10075-73-7 Product: 1,4-Bis(Methylthio)Naphthalene No suppilers available for the product. |
| Name | 1,4-Bis(Methylthio)Naphthalene |
|---|---|
| Synonyms | 1,4-Bis(Methylthio)Naphthalene; Naphthalene, 1,4-Bis(Methylthio)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12S2 |
| Molecular Weight | 220.35 |
| CAS Registry Number | 10075-73-7 |
| SMILES | C1=CC(=C2C(=C1SC)C=CC=C2)SC |
| InChI | 1S/C12H12S2/c1-13-11-7-8-12(14-2)10-6-4-3-5-9(10)11/h3-8H,1-2H3 |
| InChIKey | ZYYGYYVWYHXYOF-UHFFFAOYSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.119°C at 760 mmHg (Cal.) |
| Flash point | 187.268°C (Cal.) |
| (1) | Ãsmail Çelik, Mehmet Akkurt, Aysegül Senocak, Osman Çakmak, Laura Torre-Fernández and Santiago GarcÃa-Granda . 1,4-Bis(methylsulfanyl)naphthalene , Acta Cryst (2009). E65, o1376  |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(Methylthio)Naphthalene |