|
CAS#: 10082-95-8 Product: 2-Chloro-N-(1H-Purin-6-Yl)Acetamide No suppilers available for the product. |
| Name | 2-Chloro-N-(1H-Purin-6-Yl)Acetamide |
|---|---|
| Synonyms | 2-Chloro-N-(7H-Purin-6-Yl)Ethanamide; 6-(2-Chloroacetamido)Purine; Acetamide, 2-Chloro-N-1H-Purin-6-Yl- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClN5O |
| Molecular Weight | 211.61 |
| CAS Registry Number | 10082-95-8 |
| SMILES | C2=NC(=C1[NH]C=NC1=N2)NC(CCl)=O |
| InChI | 1S/C7H6ClN5O/c8-1-4(14)13-7-5-6(10-2-9-5)11-3-12-7/h2-3H,1H2,(H2,9,10,11,12,13,14) |
| InChIKey | KLZFMCBADSEGSF-UHFFFAOYSA-N |
| Density | 1.679g/cm3 (Cal.) |
|---|---|
| Boiling point | 650.036°C at 760 mmHg (Cal.) |
| Flash point | 346.93°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-N-(1H-Purin-6-Yl)Acetamide |