Online Database of Chemicals from Around the World
|
CAS#: 10114-60-0 Product: 2,11-Diethoxybisbenzimidazo[2,1-b:2',1'-I]Benzo[lmn][3,8]Phenanthroline-8,17-Dione No suppilers available for the product. |
| Name | 2,11-Diethoxybisbenzimidazo[2,1-b:2',1'-I]Benzo[lmn][3,8]Phenanthroline-8,17-Dione |
|---|---|
| Molecular Structure | ![CAS#: 10114-60-0, 2,11-Diethoxybisbenzimidazo[2,1-b:2',1'-I]Benzo[lmn][3,8]Phenanthroline-8,17-Dione](/moreStructures/10114-60-0.gif) |
| Molecular Formula | C30H20N4O4 |
| Molecular Weight | 500.51 |
| CAS Registry Number | 10114-60-0 |
| EINECS | 233-315-9 |
| SMILES | C5=C7C2=NC1=CC=C(C=C1[N]2C(C8=CC=C6C4=NC3=CC=C(C=C3[N]4C(C(=C5)C6=C78)=O)OCC)=O)OCC |
| InChI | 1S/C30H20N4O4/c1-3-37-15-5-11-21-23(13-15)33-27(31-21)17-7-10-20-26-18(8-9-19(25(17)26)29(33)35)28-32-22-12-6-16(38-4-2)14-24(22)34(28)30(20)36/h5-14H,3-4H2,1-2H3 |
| InChIKey | RLDUKJRGIPDRQS-UHFFFAOYSA-N |
| Density | 1.547g/cm3 (Cal.) |
|---|---|
| Boiling point | 932.89°C at 760 mmHg (Cal.) |
| Flash point | 517.993°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,11-Diethoxybisbenzimidazo[2,1-b:2',1'-I]Benzo[lmn][3,8]Phenanthroline-8,17-Dione |