|
CAS#: 10124-52-4 Product: Potassium Trihydrogen Diphosphate No suppilers available for the product. |
| Name | Potassium Trihydrogen Diphosphate |
|---|---|
| Synonyms | diphosphoric acid, potassium salt |
| Molecular Structure | ![]() |
| Molecular Formula | H3KO7P2 |
| Molecular Weight | 216.07 |
| CAS Registry Number | 10124-52-4 |
| EINECS | 233-338-4 |
| SMILES | [K+].[O-]P(=O)(O)OP(=O)(O)O |
| InChI | 1S/K.H4O7P2/c;1-8(2,3)7-9(4,5)6/h;(H2,1,2,3)(H2,4,5,6)/q+1;/p-1 |
| InChIKey | NNGFQKDWQCEMIO-UHFFFAOYSA-M |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Potassium Trihydrogen Diphosphate |