|
CAS#: 1013-08-7 Product: 1,2,3,4-Tetrahydrophenanthrene No suppilers available for the product. |
| Name | 1,2,3,4-Tetrahydrophenanthrene |
|---|---|
| Synonyms | St5440764; Nsc17533; Phenanthrene, 1,2,3,4-Tetrahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.26 |
| CAS Registry Number | 1013-08-7 |
| SMILES | C1=CC=CC2=CC=C3C(=C12)CCCC3 |
| InChI | 1S/C14H14/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1,3,5,7,9-10H,2,4,6,8H2 |
| InChIKey | UXNCDAQNSQBHEN-UHFFFAOYSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.837°C at 760 mmHg (Cal.) |
| Flash point | 156.499°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydrophenanthrene |