|
CAS#: 101365-17-7 Product: Oxymorphone 4-Nitrophenylhydrazone No suppilers available for the product. |
| Name | Oxymorphone 4-Nitrophenylhydrazone |
|---|---|
| Synonyms | Oxymorphone 4-Nitrophenylhydrazone; Oxypnph |
| Molecular Structure | ![]() |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 |
| CAS Registry Number | 101365-17-7 |
| SMILES | [C@]134[C@H]\5OC2=C(O)C=CC(=C12)C[C@@H](N(CC3)C)[C@]4(O)CCC5=N/NC6=CC=C([N+]([O-])=O)C=C6 |
| InChI | 1S/C23H24N4O5/c1-26-11-10-22-19-13-2-7-17(28)20(19)32-21(22)16(8-9-23(22,29)18(26)12-13)25-24-14-3-5-15(6-4-14)27(30)31/h2-7,18,21,24,28-29H,8-12H2,1H3/b25-16-/t18-,21+,22+,23-/m1/s1 |
| InChIKey | DPKGAKCNOIPMOW-QINNMFRESA-N |
| Density | 1.629g/cm3 (Cal.) |
|---|---|
| Boiling point | 663.487°C at 760 mmHg (Cal.) |
| Flash point | 355.065°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxymorphone 4-Nitrophenylhydrazone |