|
CAS#: 101366-50-1 Product: 3'-Nitro-4-Biphenylsulfonyl Chloride No suppilers available for the product. |
| Name | 3'-Nitro-4-Biphenylsulfonyl Chloride |
|---|---|
| Synonyms | 3-nitro-biphenyl-4-sulfonylchloride; 3'-NITRO-BIPHENYL-4-SULFONYLCHLORIDE |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClNO4S |
| Molecular Weight | 297.71 |
| CAS Registry Number | 101366-50-1 |
| SMILES | ClS(=O)(=O)c1ccc(cc1)c2cccc(c2)[N+]([O-])=O |
| InChI | 1S/C12H8ClNO4S/c13-19(17,18)12-6-4-9(5-7-12)10-2-1-3-11(8-10)14(15)16/h1-8H |
| InChIKey | KTXDVWDRGRWSJW-UHFFFAOYSA-N |
| Density | 1.465g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.837°C at 760 mmHg (Cal.) |
| Flash point | 224.04°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3'-Nitro-4-Biphenylsulfonyl Chloride |