|
CAS#: 101401-89-2 Product: 12,13-Epoxytrichothec-9-Ene-3alpha,8alpha,15-Triol 8-(3-Methylbutyrate) No suppilers available for the product. |
| Name | 12,13-Epoxytrichothec-9-Ene-3alpha,8alpha,15-Triol 8-(3-Methylbutyrate) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 |
| CAS Registry Number | 101401-89-2 |
| SMILES | [C@@]24(C1(OC1)[C@H](O[C@H]3[C@@]2(C[C@H](OC(=O)CC(C)C)C(=C3)C)CO)[C@H](O)C4)C |
| InChI | 1S/C20H30O6/c1-11(2)5-16(23)25-14-8-19(9-21)15(6-12(14)3)26-17-13(22)7-18(19,4)20(17)10-24-20/h6,11,13-15,17,21-22H,5,7-10H2,1-4H3/t13-,14+,15-,17-,18-,19-,20?/m1/s1 |
| InChIKey | RCFUVEKOPPKTBN-XHNUPVCRSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.02°C at 760 mmHg (Cal.) |
| Flash point | 170.486°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12,13-Epoxytrichothec-9-Ene-3alpha,8alpha,15-Triol 8-(3-Methylbutyrate) |