|
CAS#: 101418-01-3 Product: 2-(Diethylamino)Ethyl O-Ethoxycarbanilate Hydrochloride No suppilers available for the product. |
| Name | 2-(Diethylamino)Ethyl O-Ethoxycarbanilate Hydrochloride |
|---|---|
| Synonyms | 2-[(2-Ethoxyphenyl)Carbamoyloxy]Ethyl-Diethyl-Ammonium Chloride; 2-[[(2-Ethoxyphenyl)Amino]-Oxomethoxy]Ethyl-Diethylammonium Chloride; Diethyl-[2-(O-Phenetylcarbamoyloxy)Ethyl]Ammonium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C15H25ClN2O3 |
| Molecular Weight | 316.83 |
| CAS Registry Number | 101418-01-3 |
| SMILES | C1=C(C(=CC=C1)OCC)NC(OCC[NH+](CC)CC)=O.[Cl-] |
| InChI | 1S/C15H24N2O3.ClH/c1-4-17(5-2)11-12-20-15(18)16-13-9-7-8-10-14(13)19-6-3;/h7-10H,4-6,11-12H2,1-3H3,(H,16,18);1H |
| InChIKey | QFCLTWVISGDQCF-UHFFFAOYSA-N |
| Boiling point | 352°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 166.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Diethylamino)Ethyl O-Ethoxycarbanilate Hydrochloride |