Online Database of Chemicals from Around the World
|
CAS#: 10144-81-7 Product: 3,12-Diethoxybisbenzimidazo[2,1-b:1',2'-j]Benzo[lmn][3,8]Phenanthroline-6,9-Dione No suppilers available for the product. |
| Name | 3,12-Diethoxybisbenzimidazo[2,1-b:1',2'-j]Benzo[lmn][3,8]Phenanthroline-6,9-Dione |
|---|---|
| Molecular Structure | ![CAS#: 10144-81-7, 3,12-Diethoxybisbenzimidazo[2,1-b:1',2'-j]Benzo[lmn][3,8]Phenanthroline-6,9-Dione](/moreStructures/10144-81-7.gif) |
| Molecular Formula | C30H20N4O4 |
| Molecular Weight | 500.51 |
| CAS Registry Number | 10144-81-7 |
| EINECS | 233-413-1 |
| SMILES | C4=C6C1=NC8=C([N]1C(C7=CC=C5C([N]2C(=NC3=CC=CC(=C23)OCC)C(=C4)C5=C67)=O)=O)C=C(C=C8)OCC |
| InChI | 1S/C30H20N4O4/c1-3-37-15-8-13-20-22(14-15)33-27(31-20)16-9-10-17-25-19(12-11-18(24(16)25)29(33)35)30(36)34-26-21(32-28(17)34)6-5-7-23(26)38-4-2/h5-14H,3-4H2,1-2H3 |
| InChIKey | QPBJLJJVELJVSW-UHFFFAOYSA-N |
| Density | 1.547g/cm3 (Cal.) |
|---|---|
| Boiling point | 916.937°C at 760 mmHg (Cal.) |
| Flash point | 508.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,12-Diethoxybisbenzimidazo[2,1-b:1',2'-j]Benzo[lmn][3,8]Phenanthroline-6,9-Dione |