|
CAS#: 101564-11-8 Product: 4-[(4-Acetylphenyl)Imino]-2,6-Dichloro-2,5-Cyclohexadien-1-One No suppilers available for the product. |
| Name | 4-[(4-Acetylphenyl)Imino]-2,6-Dichloro-2,5-Cyclohexadien-1-One |
|---|---|
| Synonyms | 4-(4-Acetylphenyl)Imino-2,6-Dichloro-Cyclohexa-2,5-Dien-1-One; 4-(4-Acetylphenyl)Imino-2,6-Dichloro-1-Cyclohexa-2,5-Dienone; 2,6-Dichloro-4-(4-Ethanoylphenyl)Imino-Cyclohexa-2,5-Dien-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9Cl2NO2 |
| Molecular Weight | 294.14 |
| CAS Registry Number | 101564-11-8 |
| SMILES | C2=C(N=C1C=C(Cl)C(=O)C(=C1)Cl)C=CC(=C2)C(=O)C |
| InChI | 1S/C14H9Cl2NO2/c1-8(18)9-2-4-10(5-3-9)17-11-6-12(15)14(19)13(16)7-11/h2-7H,1H3 |
| InChIKey | ZMKDHOBBPFBRLO-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.133°C at 760 mmHg (Cal.) |
| Flash point | 153.492°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Acetylphenyl)Imino]-2,6-Dichloro-2,5-Cyclohexadien-1-One |