|
CAS#: 101688-07-7 Product: 1-(2-Nitronaphtho(2,1-b)Furan-7-Yl)-Ethanone No suppilers available for the product. |
| Name | 1-(2-Nitronaphtho(2,1-b)Furan-7-Yl)-Ethanone |
|---|---|
| Synonyms | 1-(2-Nitrobenzo[E]Benzofuran-7-Yl)Ethanone; 1-(2-Nitro-7-Benzo[E]Benzofuranyl)Ethanone; R 7542 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.23 |
| CAS Registry Number | 101688-07-7 |
| SMILES | C1=C(OC2=C1C3=C(C=C2)C=C(C=C3)C(=O)C)[N+]([O-])=O |
| InChI | 1S/C14H9NO4/c1-8(16)9-2-4-11-10(6-9)3-5-13-12(11)7-14(19-13)15(17)18/h2-7H,1H3 |
| InChIKey | KNPMKNLEQSHSEL-UHFFFAOYSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.938°C at 760 mmHg (Cal.) |
| Flash point | 225.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Nitronaphtho(2,1-b)Furan-7-Yl)-Ethanone |