|
CAS#: 101710-86-5 Product: (1-Methylpiperidin-1-Ium-4-Yl)Methyl 2-Cyclopentyl-2-Hydroxy-2-Phenylacetate Chloride No suppilers available for the product. |
| Name | (1-Methylpiperidin-1-Ium-4-Yl)Methyl 2-Cyclopentyl-2-Hydroxy-2-Phenylacetate Chloride |
|---|---|
| Synonyms | (1-Methylpiperidin-1-Ium-4-Yl)Methyl 2-Cyclopentyl-2-Hydroxy-2-Phenyl-Acetate Chloride; 2-Cyclopentyl-2-Hydroxy-2-Phenylacetic Acid (1-Methyl-4-Piperidin-1-Iumyl)Methyl Ester Chloride; 2-Cyclopentyl-2-Hydroxy-2-Phenyl-Acetic Acid (1-Methylpiperidin-1-Ium-4-Yl)Methyl Ester Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30ClNO3 |
| Molecular Weight | 367.91 |
| CAS Registry Number | 101710-86-5 |
| SMILES | C1=CC=CC=C1C(O)(C2CCCC2)C(OCC3CC[NH+](C)CC3)=O.[Cl-] |
| InChI | 1S/C20H29NO3.ClH/c1-21-13-11-16(12-14-21)15-24-19(22)20(23,18-9-5-6-10-18)17-7-3-2-4-8-17;/h2-4,7-8,16,18,23H,5-6,9-15H2,1H3;1H |
| InChIKey | SCVMNXJBRXSTTD-UHFFFAOYSA-N |
| Boiling point | 460.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 232.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Methylpiperidin-1-Ium-4-Yl)Methyl 2-Cyclopentyl-2-Hydroxy-2-Phenylacetate Chloride |