|
CAS#: 10175-95-8 Product: Zinc Dibutyl Bis[[[3,5-Bis(1,1-Dimethylethyl)-4-Hydroxyphenyl]Methyl]Phosphonate] No suppilers available for the product. |
| Name | Zinc Dibutyl Bis[[[3,5-Bis(1,1-Dimethylethyl)-4-Hydroxyphenyl]Methyl]Phosphonate] |
|---|---|
| Synonyms | Zinc Butoxy-[(3,5-Ditert-Butyl-4-Hydroxy-Phenyl)Methyl]Phosphinate; Zinc Butoxy-(3,5-Ditert-Butyl-4-Hydroxy-Benzyl)Phosphinate |
| Molecular Structure | ![]() |
| Molecular Formula | C38H64O8P2Zn |
| Molecular Weight | 776.25 |
| CAS Registry Number | 10175-95-8 |
| EINECS | 233-449-8 |
| SMILES | C1=C(C=C(C(=C1C(C)(C)C)O)C(C)(C)C)C[P](OCCCC)([O-])=O.C([P](OCCCC)([O-])=O)C2=CC(=C(O)C(=C2)C(C)(C)C)C(C)(C)C.[Zn++] |
| InChI | 1S/2C19H33O4P.Zn/c2*1-8-9-10-23-24(21,22)13-14-11-15(18(2,3)4)17(20)16(12-14)19(5,6)7;/h2*11-12,20H,8-10,13H2,1-7H3,(H,21,22);/q;;+2/p-2 |
| InChIKey | JXBMLLSGNATXRM-UHFFFAOYSA-L |
| Boiling point | 435.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 217.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zinc Dibutyl Bis[[[3,5-Bis(1,1-Dimethylethyl)-4-Hydroxyphenyl]Methyl]Phosphonate] |