| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Pyrrolnitrin |
|---|---|
| Synonyms | 3-Chloro-4-(3-Chloro-2-Nitro-Phenyl)-1H-Pyrrole; 1H-Pyrrole, 3-Chloro-4-(3-Chloro-2-Nitrophenyl)-; 3-Chloro-4-(2'-Nitro-3'-Chlorophenyl)Pyrrole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6Cl2N2O2 |
| Molecular Weight | 257.08 |
| CAS Registry Number | 1018-71-9 |
| EINECS | 213-812-7 |
| SMILES | C2=C(C1=C[NH]C=C1Cl)C(=C(C=C2)Cl)[N+](=O)[O-] |
| InChI | 1S/C10H6Cl2N2O2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12/h1-5,13H |
| InChIKey | QJBZDBLBQWFTPZ-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 202.1±28.7°C (Cal.) |
| (1) | Hui Feng, Jing Ma and Zheng Hu. Nitrogen-doped carbon nanotubes functionalized by transition metal atoms: a density functional study, J. Mater. Chem., 2010, 20, 1702. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pyrrolnitrin |