|
CAS#: 10183-45-6 Product: 16-beta-Fluoro-17-beta-(1-Oxopropoxy)-Androst-4-En-3-One No suppilers available for the product. |
| Name | 16-beta-Fluoro-17-beta-(1-Oxopropoxy)-Androst-4-En-3-One |
|---|---|
| Synonyms | Propanoic Acid (16-Fluoro-10,13-Dimethyl-3-Oxo-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-17-Yl) Ester; Propionic Acid (16-Fluoro-3-Keto-10,13-Dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-17-Yl) Ester; 16-.Beta.-Fluoro-17-.Beta.-(1-Oxopropoxy)-Androst-4-En-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C22H31FO3 |
| Molecular Weight | 362.48 |
| CAS Registry Number | 10183-45-6 |
| SMILES | C(C(OC4C3(C(C2C(C1(C(=CC(=O)CC1)CC2)C)CC3)CC4F)C)=O)C |
| InChI | 1S/C22H31FO3/c1-4-19(25)26-20-18(23)12-17-15-6-5-13-11-14(24)7-9-21(13,2)16(15)8-10-22(17,20)3/h11,15-18,20H,4-10,12H2,1-3H3 |
| InChIKey | AFBZBYQKIMBONK-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.984°C at 760 mmHg (Cal.) |
| Flash point | 224.278°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-beta-Fluoro-17-beta-(1-Oxopropoxy)-Androst-4-En-3-One |