|
CAS#: 101927-49-5 Product: 7-Bromoeudistomine D No suppilers available for the product. |
| Name | 7-Bromoeudistomine D |
|---|---|
| Synonyms | 5,7-Dibromo-9H-$B-Carbolin-6-Ol; 5,7-Dibromo-9H-Prido(3,4-B)Indol-6-Ol; 7-Bromoeudistomine D |
| Molecular Structure | ![]() |
| Molecular Formula | C11H6Br2N2O |
| Molecular Weight | 341.99 |
| CAS Registry Number | 101927-49-5 |
| SMILES | C1=C(Br)C(=C(Br)C2=C1[NH]C3=C2C=CN=C3)O |
| InChI | 1S/C11H6Br2N2O/c12-6-3-7-9(10(13)11(6)16)5-1-2-14-4-8(5)15-7/h1-4,15-16H |
| InChIKey | UNIUKKWPGRGSRQ-UHFFFAOYSA-N |
| Density | 2.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.328°C at 760 mmHg (Cal.) |
| Flash point | 240.665°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Bromoeudistomine D |