|
CAS#: 102-63-6 Product: 4-(2,4-Dimethylphenyl)Diazenyl-2-Methylaniline No suppilers available for the product. |
| Name | 4-(2,4-Dimethylphenyl)Diazenyl-2-Methylaniline |
|---|---|
| Synonyms | 4-(2,4-Dimethylphenyl)Azo-2-Methyl-Aniline; 4-(2,4-Dimethylphenyl)Azo-2-Methylaniline; [4-(2,4-Dimethylphenyl)Azo-2-Methyl-Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 |
| CAS Registry Number | 102-63-6 |
| EINECS | 203-043-5 |
| SMILES | C1=C(C(=CC(=C1)N=NC2=C(C=C(C=C2)C)C)C)N |
| InChI | 1S/C15H17N3/c1-10-4-7-15(12(3)8-10)18-17-13-5-6-14(16)11(2)9-13/h4-9H,16H2,1-3H3 |
| InChIKey | FBVBEKWBELWCNW-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.49°C at 760 mmHg (Cal.) |
| Flash point | 208.71°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,4-Dimethylphenyl)Diazenyl-2-Methylaniline |