|
CAS#: 102087-48-9 Product: 2,6-Dinitro-N,N-Dipropyl-4-(Trifluoromethyl)-1,3-Benzenediamine No suppilers available for the product. |
| Name | 2,6-Dinitro-N,N-Dipropyl-4-(Trifluoromethyl)-1,3-Benzenediamine |
|---|---|
| Synonyms | 1,3-Benze |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17F3N4O4 |
| Molecular Weight | 350.29 |
| CAS Registry Number | 102087-48-9 |
| SMILES | CCCN(CCC)C1=C(C=C(C(=C1[N+](=O)[O-])N)C(F)(F)F)[N+](=O)[O-] |
| InChI | 1S/C13H17F3N4O4/c1-3-5-18(6-4-2)11-9(19(21)22)7-8(13(14,15)16)10(17)12(11)20(23)24/h7H,3-6,17H2,1-2H3 |
| InChIKey | RSVPPPHXAASNOL-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 215.7±28.7°C (Cal.) |
| Refractive index | 1.557 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dinitro-N,N-Dipropyl-4-(Trifluoromethyl)-1,3-Benzenediamine |