Online Database of Chemicals from Around the World
|
CAS#: 102244-08-6 Product: 2-Chloro-9-(4-Quinazolinylthio)-Acridine No suppilers available for the product. |
| Name | 2-Chloro-9-(4-Quinazolinylthio)-Acridine |
|---|---|
| Synonyms | 2-Chloro-9-Quinazolin-4-Ylsulfanyl-Acridine; 2-Chloro-9-(4-Quinazolinylthio)Acridine; 2-Chloro-9-(Quinazolin-4-Ylthio)Acridine |
| Molecular Structure |  |
| Molecular Formula | C21H12ClN3S |
| Molecular Weight | 373.86 |
| CAS Registry Number | 102244-08-6 |
| SMILES | C1=C(C=CC2=C1C(=C3C(=N2)C=CC=C3)SC4=C5C(=NC=N4)C=CC=C5)Cl |
| InChI | 1S/C21H12ClN3S/c22-13-9-10-19-16(11-13)20(14-5-1-4-8-18(14)25-19)26-21-15-6-2-3-7-17(15)23-12-24-21/h1-12H |
| InChIKey | LLLWIYPZJYCYHG-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.763°C at 760 mmHg (Cal.) |
| Flash point | 327.411°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-9-(4-Quinazolinylthio)-Acridine |