|
CAS#: 10225-40-8 Product: 2-Sec-Butyl-1-Phenyl-1,3-Butanedione No suppilers available for the product. |
| Name | 2-Sec-Butyl-1-Phenyl-1,3-Butanedione |
|---|---|
| Synonyms | 1-PHENYL-2-SEC-BUTYL-1,3-BUTANEDIONE; 2-Sec-butyl-1-phenyl-1,3-butanedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 10225-40-8 |
| SMILES | O=C(c1ccccc1)C(C(=O)C)C(C)CC |
| InChI | 1S/C14H18O2/c1-4-10(2)13(11(3)15)14(16)12-8-6-5-7-9-12/h5-10,13H,4H2,1-3H3 |
| InChIKey | KYIVSKWOJCLODL-UHFFFAOYSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.103°C at 760 mmHg (Cal.) |
| Flash point | 117.943°C (Cal.) |
| Refractive index | 1.499 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Sec-Butyl-1-Phenyl-1,3-Butanedione |